C16H17NO4 — CID 28943253
3-[(2-oxoazepan-1-yl)methyl]-1-benzofuran-2-carboxylic acid (PubChem CID 28943253) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is 3-[(2-oxoazepan-1-yl)methyl]-1-benzofuran-2-carboxylic acid.
| Compound Name | 3-[(2-oxoazepan-1-yl)methyl]-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 28943253 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 3-[(2-oxoazepan-1-yl)methyl]-1-benzofuran-2-carboxylic acid |
| SMILES | O=C(O)c1oc2ccccc2c1CN1CCCCCC1=O |
| InChI | InChI=1S/C16H17NO4/c18-14-8-2-1-5-9-17(14)10-12-11-6-3-4-7-13(11)21-15(12)16(19)20/h3-4,6-7H,1-2,5,8-10H2,(H,19,20) |
| InChIKey | DZGABXZRGGPVME-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |