C14H10N2O4 — CID 28943249
3-[(2-oxopyrimidin-1-yl)methyl]-1-benzofuran-2-carboxylic acid (PubChem CID 28943249) has the molecular formula C14H10N2O4 and a molecular weight of 270.24 g/mol. Its IUPAC name is 3-[(2-oxopyrimidin-1-yl)methyl]-1-benzofuran-2-carboxylic acid.
| Compound Name | 3-[(2-oxopyrimidin-1-yl)methyl]-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 28943249 |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 3-[(2-oxopyrimidin-1-yl)methyl]-1-benzofuran-2-carboxylic acid |
| SMILES | O=C(O)c1oc2ccccc2c1Cn1cccnc1=O |
| InChI | InChI=1S/C14H10N2O4/c17-13(18)12-10(8-16-7-3-6-15-14(16)19)9-4-1-2-5-11(9)20-12/h1-7H,8H2,(H,17,18) |
| InChIKey | SIWKCIHHRUGSSX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |