C19H20N4O4 — CID 138003725
3-[[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methyl]-1-benzofuran-2-carboxylic acid (PubChem CID 138003725) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is 3-[[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methyl]-1-benzofuran-2-carboxylic acid.
| Compound Name | 3-[[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methyl]-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 138003725 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 3-[[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methyl]-1-benzofuran-2-carboxylic acid |
| SMILES | COc1ccnc(N2CCN(Cc3c(C(=O)O)oc4ccccc34)CC2)n1 |
| InChI | InChI=1S/C19H20N4O4/c1-26-16-6-7-20-19(21-16)23-10-8-22(9-11-23)12-14-13-4-2-3-5-15(13)27-17(14)18(24)25/h2-7H,8-12H2,1H3,(H,24,25) |
| InChIKey | PJOBJYHQYQNDGB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |