C20H22N4O3 — CID 8542010
ethyl 3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1-benzofuran-2-carboxylate (PubChem CID 8542010) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is ethyl 3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 8542010 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | ethyl 3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccccc2c1CN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C20H22N4O3/c1-2-26-19(25)18-16(15-6-3-4-7-17(15)27-18)14-23-10-12-24(13-11-23)20-21-8-5-9-22-20/h3-9H,2,10-14H2,1H3 |
| InChIKey | HHDBVSFKLJSRMP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 71.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |