C21H22N2O5 — CID 34830930
ethyl 3-[[4-(furan-3-carbonyl)piperazin-1-yl]methyl]-1-benzofuran-2-carboxylate (PubChem CID 34830930) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is ethyl 3-[[4-(furan-3-carbonyl)piperazin-1-yl]methyl]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 3-[[4-(furan-3-carbonyl)piperazin-1-yl]methyl]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 34830930 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | ethyl 3-[[4-(furan-3-carbonyl)piperazin-1-yl]methyl]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccccc2c1CN1CCN(C(=O)c2ccoc2)CC1 |
| InChI | InChI=1S/C21H22N2O5/c1-2-27-21(25)19-17(16-5-3-4-6-18(16)28-19)13-22-8-10-23(11-9-22)20(24)15-7-12-26-14-15/h3-7,12,14H,2,8-11,13H2,1H3 |
| InChIKey | BSCLLNBMHSZUKB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 76.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |