C18H18N2O6 — CID 71909552
ethyl 3-[(2,4-dioxo-7-oxa-1,3-diazaspiro[4.4]nonan-3-yl)methyl]-1-benzofuran-2-carboxylate (PubChem CID 71909552) has the molecular formula C18H18N2O6 and a molecular weight of 358.35 g/mol. Its IUPAC name is ethyl 3-[(2,4-dioxo-7-oxa-1,3-diazaspiro[4.4]nonan-3-yl)methyl]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 3-[(2,4-dioxo-7-oxa-1,3-diazaspiro[4.4]nonan-3-yl)methyl]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 71909552 |
| Molecular Formula | C18H18N2O6 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | ethyl 3-[(2,4-dioxo-7-oxa-1,3-diazaspiro[4.4]nonan-3-yl)methyl]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccccc2c1CN1C(=O)NC2(CCOC2)C1=O |
| InChI | InChI=1S/C18H18N2O6/c1-2-25-15(21)14-12(11-5-3-4-6-13(11)26-14)9-20-16(22)18(19-17(20)23)7-8-24-10-18/h3-6H,2,7-10H2,1H3,(H,19,23) |
| InChIKey | XORBCYNSAFMTIH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|