C22H19NO5 — CID 155564660
1-[(8-hydroxy-6-oxo-[1]benzofuro[3,2-c]chromen-7-yl)methyl]azepan-2-one (PubChem CID 155564660) has the molecular formula C22H19NO5 and a molecular weight of 377.40 g/mol. Its IUPAC name is 1-[(8-hydroxy-6-oxo-[1]benzofuro[3,2-c]chromen-7-yl)methyl]azepan-2-one.
| Compound Name | 1-[(8-hydroxy-6-oxo-[1]benzofuro[3,2-c]chromen-7-yl)methyl]azepan-2-one |
|---|---|
| PubChem CID | 155564660 |
| Molecular Formula | C22H19NO5 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 1-[(8-hydroxy-6-oxo-[1]benzofuro[3,2-c]chromen-7-yl)methyl]azepan-2-one |
| SMILES | O=C1CCCCCN1Cc1c(O)ccc2oc3c4ccccc4oc(=O)c3c12 |
| InChI | InChI=1S/C22H19NO5/c24-15-9-10-17-19(14(15)12-23-11-5-1-2-8-18(23)25)20-21(27-17)13-6-3-4-7-16(13)28-22(20)26/h3-4,6-7,9-10,24H,1-2,5,8,11-12H2 |
| InChIKey | CRXWLDJVYBNPNY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|