C14H14O6 — CID 102452597
methyl 5-[(E)-3-methoxy-3-oxoprop-1-enyl]-2,3-dihydro-1,4-benzodioxine-6-carboxylate (PubChem CID 102452597) has the molecular formula C14H14O6 and a molecular weight of 278.26 g/mol. Its IUPAC name is methyl 5-[(E)-3-methoxy-3-oxoprop-1-enyl]-2,3-dihydro-1,4-benzodioxine-6-carboxylate.
| Compound Name | methyl 5-[(E)-3-methoxy-3-oxoprop-1-enyl]-2,3-dihydro-1,4-benzodioxine-6-carboxylate |
|---|---|
| PubChem CID | 102452597 |
| Molecular Formula | C14H14O6 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | methyl 5-[(E)-3-methoxy-3-oxoprop-1-enyl]-2,3-dihydro-1,4-benzodioxine-6-carboxylate |
| SMILES | COC(=O)/C=C/c1c(C(=O)OC)ccc2c1OCCO2 |
| InChI | InChI=1S/C14H14O6/c1-17-12(15)6-4-9-10(14(16)18-2)3-5-11-13(9)20-8-7-19-11/h3-6H,7-8H2,1-2H3/b6-4+ |
| InChIKey | RTUHDISUBZXVFE-GQCTYLIASA-N |
| XLogP | 1.43 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|