C14H17NO4 — CID 59066356
(Z)-3-(dimethylamino)-1-(5-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-en-1-one (PubChem CID 59066356) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is (Z)-3-(dimethylamino)-1-(5-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-en-1-one.
| Compound Name | (Z)-3-(dimethylamino)-1-(5-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 59066356 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | (Z)-3-(dimethylamino)-1-(5-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-en-1-one |
| SMILES | COc1c(C(=O)/C=C\N(C)C)ccc2c1OCCO2 |
| InChI | InChI=1S/C14H17NO4/c1-15(2)7-6-11(16)10-4-5-12-14(13(10)17-3)19-9-8-18-12/h4-7H,8-9H2,1-3H3/b7-6- |
| InChIKey | DVKXTSXAIYBGSC-SREVYHEPSA-N |
| XLogP | 1.72 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|