C32H43NO7 — CID 67948023
methyl 7-[3-[4-[3-(dimethylamino)prop-2-enoyl]-3-methoxy-2-propylphenoxy]propoxy]-8-propyl-3,4-dihydro-2H-chromene-2-carboxylate (PubChem CID 67948023) has the molecular formula C32H43NO7 and a molecular weight of 553.70 g/mol. Its IUPAC name is methyl 7-[3-[4-[3-(dimethylamino)prop-2-enoyl]-3-methoxy-2-propylphenoxy]propoxy]-8-propyl-3,4-dihydro-2H-chromene-2-carboxylate.
| Compound Name | methyl 7-[3-[4-[3-(dimethylamino)prop-2-enoyl]-3-methoxy-2-propylphenoxy]propoxy]-8-propyl-3,4-dihydro-2H-chromene-2-carboxylate |
|---|---|
| PubChem CID | 67948023 |
| Molecular Formula | C32H43NO7 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.30 |
| IUPAC Name | methyl 7-[3-[4-[3-(dimethylamino)prop-2-enoyl]-3-methoxy-2-propylphenoxy]propoxy]-8-propyl-3,4-dihydro-2H-chromene-2-carboxylate |
| SMILES | CCCc1c(OCCCOc2ccc(C(=O)C=CN(C)C)c(OC)c2CCC)ccc2c1OC(C(=O)OC)CC2 |
| InChI | InChI=1S/C32H43NO7/c1-7-10-24-27(15-12-22-13-16-29(32(35)37-6)40-30(22)24)38-20-9-21-39-28-17-14-23(26(34)18-19-33(3)4)31(36-5)25(28)11-8-2/h12,14-15,17-19,29H,7-11,13,16,20-21H2,1-6H3 |
| InChIKey | JPIINUFUAIMEBN-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|