C30H35NO7 — CID 14989451
methyl 7-[3-[3-methoxy-4-(1,2-oxazol-3-yl)-2-prop-2-enylphenoxy]propoxy]-8-propyl-3,4-dihydro-2H-chromene-2-carboxylate (PubChem CID 14989451) has the molecular formula C30H35NO7 and a molecular weight of 521.61 g/mol. Its IUPAC name is methyl 7-[3-[3-methoxy-4-(1,2-oxazol-3-yl)-2-prop-2-enylphenoxy]propoxy]-8-propyl-3,4-dihydro-2H-chromene-2-carboxylate.
| Compound Name | methyl 7-[3-[3-methoxy-4-(1,2-oxazol-3-yl)-2-prop-2-enylphenoxy]propoxy]-8-propyl-3,4-dihydro-2H-chromene-2-carboxylate |
|---|---|
| PubChem CID | 14989451 |
| Molecular Formula | C30H35NO7 |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | methyl 7-[3-[3-methoxy-4-(1,2-oxazol-3-yl)-2-prop-2-enylphenoxy]propoxy]-8-propyl-3,4-dihydro-2H-chromene-2-carboxylate |
| SMILES | C=CCc1c(OCCCOc2ccc3c(c2CCC)OC(C(=O)OC)CC3)ccc(-c2ccon2)c1OC |
| InChI | InChI=1S/C30H35NO7/c1-5-8-22-25(13-10-20-11-14-27(30(32)34-4)38-28(20)22)35-17-7-18-36-26-15-12-21(24-16-19-37-31-24)29(33-3)23(26)9-6-2/h6,10,12-13,15-16,19,27H,2,5,7-9,11,14,17-18H2,1,3-4H3 |
| InChIKey | SLKMHGFJIXCIJH-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 89.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|