C29H37ClO7 — CID 10030026
methyl 7-[3-[4-(2-chloroacetyl)-3-methoxy-2-propylphenoxy]propoxy]-8-propyl-3,4-dihydro-2H-chromene-2-carboxylate (PubChem CID 10030026) has the molecular formula C29H37ClO7 and a molecular weight of 533.06 g/mol. Its IUPAC name is methyl 7-[3-[4-(2-chloroacetyl)-3-methoxy-2-propylphenoxy]propoxy]-8-propyl-3,4-dihydro-2H-chromene-2-carboxylate.
| Compound Name | methyl 7-[3-[4-(2-chloroacetyl)-3-methoxy-2-propylphenoxy]propoxy]-8-propyl-3,4-dihydro-2H-chromene-2-carboxylate |
|---|---|
| PubChem CID | 10030026 |
| Molecular Formula | C29H37ClO7 |
| Molecular Weight | 533.06 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | methyl 7-[3-[4-(2-chloroacetyl)-3-methoxy-2-propylphenoxy]propoxy]-8-propyl-3,4-dihydro-2H-chromene-2-carboxylate |
| SMILES | CCCc1c(OCCCOc2ccc(C(=O)CCl)c(OC)c2CCC)ccc2c1OC(C(=O)OC)CC2 |
| InChI | InChI=1S/C29H37ClO7/c1-5-8-21-24(13-10-19-11-14-26(29(32)34-4)37-27(19)21)35-16-7-17-36-25-15-12-20(23(31)18-30)28(33-3)22(25)9-6-2/h10,12-13,15,26H,5-9,11,14,16-18H2,1-4H3 |
| InChIKey | OZHPGALQKMTKOC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.06 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|