C29H39NO6 — CID 57115311
3-[3-(4-acetyl-3-methoxy-2-propylphenoxy)propoxy]-N-methyl-8-propyl-3,4-dihydro-2H-chromene-2-carboxamide (PubChem CID 57115311) has the molecular formula C29H39NO6 and a molecular weight of 497.63 g/mol. Its IUPAC name is 3-[3-(4-acetyl-3-methoxy-2-propylphenoxy)propoxy]-N-methyl-8-propyl-3,4-dihydro-2H-chromene-2-carboxamide.
| Compound Name | 3-[3-(4-acetyl-3-methoxy-2-propylphenoxy)propoxy]-N-methyl-8-propyl-3,4-dihydro-2H-chromene-2-carboxamide |
|---|---|
| PubChem CID | 57115311 |
| Molecular Formula | C29H39NO6 |
| Molecular Weight | 497.63 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | 3-[3-(4-acetyl-3-methoxy-2-propylphenoxy)propoxy]-N-methyl-8-propyl-3,4-dihydro-2H-chromene-2-carboxamide |
| SMILES | CCCc1cccc2c1OC(C(=O)NC)C(OCCCOc1ccc(C(C)=O)c(OC)c1CCC)C2 |
| InChI | InChI=1S/C29H39NO6/c1-6-10-20-12-8-13-21-18-25(28(29(32)30-4)36-26(20)21)35-17-9-16-34-24-15-14-22(19(3)31)27(33-5)23(24)11-7-2/h8,12-15,25,28H,6-7,9-11,16-18H2,1-5H3,(H,30,32) |
| InChIKey | JGOVIEBITPNRRX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.63 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|