C15H17NO6 — CID 71605327
(E)-3-[5-(diethylcarbamoyloxy)-1,3-benzodioxol-4-yl]prop-2-enoic acid (PubChem CID 71605327) has the molecular formula C15H17NO6 and a molecular weight of 307.30 g/mol. Its IUPAC name is (E)-3-[5-(diethylcarbamoyloxy)-1,3-benzodioxol-4-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(diethylcarbamoyloxy)-1,3-benzodioxol-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 71605327 |
| Molecular Formula | C15H17NO6 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | (E)-3-[5-(diethylcarbamoyloxy)-1,3-benzodioxol-4-yl]prop-2-enoic acid |
| SMILES | CCN(CC)C(=O)Oc1ccc2c(c1/C=C/C(=O)O)OCO2 |
| InChI | InChI=1S/C15H17NO6/c1-3-16(4-2)15(19)22-11-6-7-12-14(21-9-20-12)10(11)5-8-13(17)18/h5-8H,3-4,9H2,1-2H3,(H,17,18)/b8-5+ |
| InChIKey | ZAGDIECPUSWPAB-VMPITWQZSA-N |
| XLogP | 2.35 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|