C9H7Br2FO2 — CID 156842053
2-(2,6-dibromo-4-fluorophenyl)-1,3-dioxolane (PubChem CID 156842053) has the molecular formula C9H7Br2FO2 and a molecular weight of 325.96 g/mol. Its IUPAC name is 2-(2,6-dibromo-4-fluorophenyl)-1,3-dioxolane.
| Compound Name | 2-(2,6-dibromo-4-fluorophenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 156842053 |
| Molecular Formula | C9H7Br2FO2 |
| Molecular Weight | 325.96 g/mol |
| Exact Mass | 323.88 |
| IUPAC Name | 2-(2,6-dibromo-4-fluorophenyl)-1,3-dioxolane |
| SMILES | Fc1cc(Br)c(C2OCCO2)c(Br)c1 |
| InChI | InChI=1S/C9H7Br2FO2/c10-6-3-5(12)4-7(11)8(6)9-13-1-2-14-9/h3-4,9H,1-2H2 |
| InChIKey | QOEWUHUYQIYHJH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.96 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |