C9H7BrClFO — CID 130935590
5-bromo-4-chloro-7-fluoro-3,4-dihydro-2H-chromene (PubChem CID 130935590) has the molecular formula C9H7BrClFO and a molecular weight of 265.51 g/mol. Its IUPAC name is 5-bromo-4-chloro-7-fluoro-3,4-dihydro-2H-chromene.
| Compound Name | 5-bromo-4-chloro-7-fluoro-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 130935590 |
| Molecular Formula | C9H7BrClFO |
| Molecular Weight | 265.51 g/mol |
| Exact Mass | 263.94 |
| IUPAC Name | 5-bromo-4-chloro-7-fluoro-3,4-dihydro-2H-chromene |
| SMILES | Fc1cc(Br)c2c(c1)OCCC2Cl |
| InChI | InChI=1S/C9H7BrClFO/c10-6-3-5(12)4-8-9(6)7(11)1-2-13-8/h3-4,7H,1-2H2 |
| InChIKey | JHKDGEZXNACKKC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|