C9H7BrCl2O — CID 130848796
5-bromo-4,6-dichloro-3,4-dihydro-2H-chromene (PubChem CID 130848796) has the molecular formula C9H7BrCl2O and a molecular weight of 281.96 g/mol. Its IUPAC name is 5-bromo-4,6-dichloro-3,4-dihydro-2H-chromene.
| Compound Name | 5-bromo-4,6-dichloro-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 130848796 |
| Molecular Formula | C9H7BrCl2O |
| Molecular Weight | 281.96 g/mol |
| Exact Mass | 279.91 |
| IUPAC Name | 5-bromo-4,6-dichloro-3,4-dihydro-2H-chromene |
| SMILES | Clc1ccc2c(c1Br)C(Cl)CCO2 |
| InChI | InChI=1S/C9H7BrCl2O/c10-9-6(12)1-2-7-8(9)5(11)3-4-13-7/h1-2,5H,3-4H2 |
| InChIKey | RSMMCZWOEMMOMO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.96 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|