C10H11ClOS — CID 130792885
6-chloro-5-methyl-3,4-dihydro-2H-chromene-4-thiol (PubChem CID 130792885) has the molecular formula C10H11ClOS and a molecular weight of 214.72 g/mol. Its IUPAC name is 6-chloro-5-methyl-3,4-dihydro-2H-chromene-4-thiol.
| Compound Name | 6-chloro-5-methyl-3,4-dihydro-2H-chromene-4-thiol |
|---|---|
| PubChem CID | 130792885 |
| Molecular Formula | C10H11ClOS |
| Molecular Weight | 214.72 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | 6-chloro-5-methyl-3,4-dihydro-2H-chromene-4-thiol |
| SMILES | Cc1c(Cl)ccc2c1C(S)CCO2 |
| InChI | InChI=1S/C10H11ClOS/c1-6-7(11)2-3-8-10(6)9(13)4-5-12-8/h2-3,9,13H,4-5H2,1H3 |
| InChIKey | KENHLZGKSPVTJL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.72 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|