C10H10F2O — CID 171497212
3-ethyl-4,6-difluoro-2,3-dihydro-1-benzofuran (PubChem CID 171497212) has the molecular formula C10H10F2O and a molecular weight of 184.19 g/mol. Its IUPAC name is 3-ethyl-4,6-difluoro-2,3-dihydro-1-benzofuran.
| Compound Name | 3-ethyl-4,6-difluoro-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 171497212 |
| Molecular Formula | C10H10F2O |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 3-ethyl-4,6-difluoro-2,3-dihydro-1-benzofuran |
| SMILES | CCC1COc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C10H10F2O/c1-2-6-5-13-9-4-7(11)3-8(12)10(6)9/h3-4,6H,2,5H2,1H3 |
| InChIKey | HFXYIUOBFZRIHT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |