C9H7BrClFO2 — CID 155293758
2-(6-bromo-3-chloro-2-fluorophenyl)-1,3-dioxolane (PubChem CID 155293758) has the molecular formula C9H7BrClFO2 and a molecular weight of 281.51 g/mol. Its IUPAC name is 2-(6-bromo-3-chloro-2-fluorophenyl)-1,3-dioxolane.
| Compound Name | 2-(6-bromo-3-chloro-2-fluorophenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 155293758 |
| Molecular Formula | C9H7BrClFO2 |
| Molecular Weight | 281.51 g/mol |
| Exact Mass | 279.93 |
| IUPAC Name | 2-(6-bromo-3-chloro-2-fluorophenyl)-1,3-dioxolane |
| SMILES | Fc1c(Cl)ccc(Br)c1C1OCCO1 |
| InChI | InChI=1S/C9H7BrClFO2/c10-5-1-2-6(11)8(12)7(5)9-13-3-4-14-9/h1-2,9H,3-4H2 |
| InChIKey | YVKMPQUJLSGOGK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|