C12H13NO7 — CID 12928000
[5-(1,3-dioxolan-2-yl)-2-methoxy-3-nitrophenyl] acetate (PubChem CID 12928000) has the molecular formula C12H13NO7 and a molecular weight of 283.24 g/mol. Its IUPAC name is [5-(1,3-dioxolan-2-yl)-2-methoxy-3-nitrophenyl] acetate.
| Compound Name | [5-(1,3-dioxolan-2-yl)-2-methoxy-3-nitrophenyl] acetate |
|---|---|
| PubChem CID | 12928000 |
| Molecular Formula | C12H13NO7 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | [5-(1,3-dioxolan-2-yl)-2-methoxy-3-nitrophenyl] acetate |
| SMILES | COc1c(OC(C)=O)cc(C2OCCO2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13NO7/c1-7(14)20-10-6-8(12-18-3-4-19-12)5-9(13(15)16)11(10)17-2/h5-6,12H,3-4H2,1-2H3 |
| InChIKey | LXNOLYMAGQRREP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|