C18H8Br2Cl2 — CID 141434440
1,12-dibromo-2,3-dichlorobenzo[c]phenanthrene (PubChem CID 141434440) has the molecular formula C18H8Br2Cl2 and a molecular weight of 454.98 g/mol. Its IUPAC name is 1,12-dibromo-2,3-dichlorobenzo[c]phenanthrene.
| Compound Name | 1,12-dibromo-2,3-dichlorobenzo[c]phenanthrene |
|---|---|
| PubChem CID | 141434440 |
| Molecular Formula | C18H8Br2Cl2 |
| Molecular Weight | 454.98 g/mol |
| Exact Mass | 451.84 |
| IUPAC Name | 1,12-dibromo-2,3-dichlorobenzo[c]phenanthrene |
| SMILES | Clc1cc2ccc3ccc4cccc(Br)c4c3c2c(Br)c1Cl |
| InChI | InChI=1S/C18H8Br2Cl2/c19-12-3-1-2-9-4-5-10-6-7-11-8-13(21)18(22)17(20)16(11)15(10)14(9)12/h1-8H |
| InChIKey | SKKJECXGWHXKNK-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.98 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|