C12H4Br4O — CID 526230
1,2,3,6-tetrabromodibenzofuran (PubChem CID 526230) has the molecular formula C12H4Br4O and a molecular weight of 483.78 g/mol. Its IUPAC name is 1,2,3,6-tetrabromodibenzofuran.
| Compound Name | 1,2,3,6-tetrabromodibenzofuran |
|---|---|
| PubChem CID | 526230 |
| Molecular Formula | C12H4Br4O |
| Molecular Weight | 483.78 g/mol |
| Exact Mass | 479.70 |
| IUPAC Name | 1,2,3,6-tetrabromodibenzofuran |
| SMILES | Brc1cc2oc3c(Br)cccc3c2c(Br)c1Br |
| InChI | InChI=1S/C12H4Br4O/c13-6-3-1-2-5-9-8(17-12(5)6)4-7(14)10(15)11(9)16/h1-4H |
| InChIKey | POHZMKFDLJSOEY-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.78 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|