C6HAsBr2F2O — CID 172524619
1-arsoroso-3,5-dibromo-2,4-difluorobenzene (PubChem CID 172524619) has the molecular formula C6HAsBr2F2O and a molecular weight of 361.80 g/mol. Its IUPAC name is 1-arsoroso-3,5-dibromo-2,4-difluorobenzene.
| Compound Name | 1-arsoroso-3,5-dibromo-2,4-difluorobenzene |
|---|---|
| PubChem CID | 172524619 |
| Molecular Formula | C6HAsBr2F2O |
| Molecular Weight | 361.80 g/mol |
| Exact Mass | 359.76 |
| IUPAC Name | 1-arsoroso-3,5-dibromo-2,4-difluorobenzene |
| SMILES | O=[As]c1cc(Br)c(F)c(Br)c1F |
| InChI | InChI=1S/C6HAsBr2F2O/c8-3-1-2(7-12)5(10)4(9)6(3)11/h1H |
| InChIKey | VCHGSYVRCOIPCH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.80 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|