C10H5F6IO3 — CID 134638431
2-hydroxy-2-[3-iodo-4,5-bis(trifluoromethyl)phenyl]acetic acid (PubChem CID 134638431) has the molecular formula C10H5F6IO3 and a molecular weight of 414.04 g/mol. Its IUPAC name is 2-hydroxy-2-[3-iodo-4,5-bis(trifluoromethyl)phenyl]acetic acid.
| Compound Name | 2-hydroxy-2-[3-iodo-4,5-bis(trifluoromethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 134638431 |
| Molecular Formula | C10H5F6IO3 |
| Molecular Weight | 414.04 g/mol |
| Exact Mass | 413.92 |
| IUPAC Name | 2-hydroxy-2-[3-iodo-4,5-bis(trifluoromethyl)phenyl]acetic acid |
| SMILES | O=C(O)C(O)c1cc(I)c(C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H5F6IO3/c11-9(12,13)4-1-3(7(18)8(19)20)2-5(17)6(4)10(14,15)16/h1-2,7,18H,(H,19,20) |
| InChIKey | USKLVTQBQAUSSA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.04 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|