C9H8BrIO3 — CID 171000893
2-(3-bromo-5-iodo-4-methylphenyl)-2-hydroxyacetic acid (PubChem CID 171000893) has the molecular formula C9H8BrIO3 and a molecular weight of 370.97 g/mol. Its IUPAC name is 2-(3-bromo-5-iodo-4-methylphenyl)-2-hydroxyacetic acid.
| Compound Name | 2-(3-bromo-5-iodo-4-methylphenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 171000893 |
| Molecular Formula | C9H8BrIO3 |
| Molecular Weight | 370.97 g/mol |
| Exact Mass | 369.87 |
| IUPAC Name | 2-(3-bromo-5-iodo-4-methylphenyl)-2-hydroxyacetic acid |
| SMILES | Cc1c(Br)cc(C(O)C(=O)O)cc1I |
| InChI | InChI=1S/C9H8BrIO3/c1-4-6(10)2-5(3-7(4)11)8(12)9(13)14/h2-3,8,12H,1H3,(H,13,14) |
| InChIKey | YKFIGBSGYDWCFC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.97 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|