C9H7F3O5 — CID 117383096
2-[4,5-dihydroxy-2-(trifluoromethyl)phenyl]-2-hydroxyacetic acid (PubChem CID 117383096) has the molecular formula C9H7F3O5 and a molecular weight of 252.14 g/mol. Its IUPAC name is 2-[4,5-dihydroxy-2-(trifluoromethyl)phenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[4,5-dihydroxy-2-(trifluoromethyl)phenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 117383096 |
| Molecular Formula | C9H7F3O5 |
| Molecular Weight | 252.14 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 2-[4,5-dihydroxy-2-(trifluoromethyl)phenyl]-2-hydroxyacetic acid |
| SMILES | O=C(O)C(O)c1cc(O)c(O)cc1C(F)(F)F |
| InChI | InChI=1S/C9H7F3O5/c10-9(11,12)4-2-6(14)5(13)1-3(4)7(15)8(16)17/h1-2,7,13-15H,(H,16,17) |
| InChIKey | HPYMHMIQTPRFPB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.14 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|