C10H8F3NO5 — CID 66513236
5-[(S)-amino(carboxy)methyl]-4-hydroxy-2-(trifluoromethyl)benzoic acid (PubChem CID 66513236) has the molecular formula C10H8F3NO5 and a molecular weight of 279.17 g/mol. Its IUPAC name is 5-[(S)-amino(carboxy)methyl]-4-hydroxy-2-(trifluoromethyl)benzoic acid.
| Compound Name | 5-[(S)-amino(carboxy)methyl]-4-hydroxy-2-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 66513236 |
| Molecular Formula | C10H8F3NO5 |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 5-[(S)-amino(carboxy)methyl]-4-hydroxy-2-(trifluoromethyl)benzoic acid |
| SMILES | N[C@H](C(=O)O)c1cc(C(=O)O)c(C(F)(F)F)cc1O |
| InChI | InChI=1S/C10H8F3NO5/c11-10(12,13)5-2-6(15)4(7(14)9(18)19)1-3(5)8(16)17/h1-2,7,15H,14H2,(H,16,17)(H,18,19)/t7-/m0/s1 |
| InChIKey | QNBPRONNLCIASS-ZETCQYMHSA-N |
| XLogP | 1.19 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|