C9H9F3N2O2 — CID 66512963
(2S)-2-amino-2-[4-amino-3-(trifluoromethyl)phenyl]acetic acid (PubChem CID 66512963) has the molecular formula C9H9F3N2O2 and a molecular weight of 234.18 g/mol. Its IUPAC name is (2S)-2-amino-2-[4-amino-3-(trifluoromethyl)phenyl]acetic acid.
| Compound Name | (2S)-2-amino-2-[4-amino-3-(trifluoromethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 66512963 |
| Molecular Formula | C9H9F3N2O2 |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | (2S)-2-amino-2-[4-amino-3-(trifluoromethyl)phenyl]acetic acid |
| SMILES | Nc1ccc([C@H](N)C(=O)O)cc1C(F)(F)F |
| InChI | InChI=1S/C9H9F3N2O2/c10-9(11,12)5-3-4(1-2-6(5)13)7(14)8(15)16/h1-3,7H,13-14H2,(H,15,16)/t7-/m0/s1 |
| InChIKey | ZNVQJTGNQDYGRZ-ZETCQYMHSA-N |
| XLogP | 1.37 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|