C11H13BrOS2 — CID 118843529
1-[3,5-bis(methylsulfanyl)phenyl]-2-bromopropan-1-one (PubChem CID 118843529) has the molecular formula C11H13BrOS2 and a molecular weight of 305.26 g/mol. Its IUPAC name is 1-[3,5-bis(methylsulfanyl)phenyl]-2-bromopropan-1-one.
| Compound Name | 1-[3,5-bis(methylsulfanyl)phenyl]-2-bromopropan-1-one |
|---|---|
| PubChem CID | 118843529 |
| Molecular Formula | C11H13BrOS2 |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 303.96 |
| IUPAC Name | 1-[3,5-bis(methylsulfanyl)phenyl]-2-bromopropan-1-one |
| SMILES | CSc1cc(SC)cc(C(=O)C(C)Br)c1 |
| InChI | InChI=1S/C11H13BrOS2/c1-7(12)11(13)8-4-9(14-2)6-10(5-8)15-3/h4-7H,1-3H3 |
| InChIKey | PNHIEOJIQKIIHA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|