C11H9BrClF3OS — CID 134618785
2-bromo-1-[3-(chloromethyl)-5-(trifluoromethylsulfanyl)phenyl]propan-1-one (PubChem CID 134618785) has the molecular formula C11H9BrClF3OS and a molecular weight of 361.61 g/mol. Its IUPAC name is 2-bromo-1-[3-(chloromethyl)-5-(trifluoromethylsulfanyl)phenyl]propan-1-one.
| Compound Name | 2-bromo-1-[3-(chloromethyl)-5-(trifluoromethylsulfanyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 134618785 |
| Molecular Formula | C11H9BrClF3OS |
| Molecular Weight | 361.61 g/mol |
| Exact Mass | 359.92 |
| IUPAC Name | 2-bromo-1-[3-(chloromethyl)-5-(trifluoromethylsulfanyl)phenyl]propan-1-one |
| SMILES | CC(Br)C(=O)c1cc(CCl)cc(SC(F)(F)F)c1 |
| InChI | InChI=1S/C11H9BrClF3OS/c1-6(12)10(17)8-2-7(5-13)3-9(4-8)18-11(14,15)16/h2-4,6H,5H2,1H3 |
| InChIKey | OWRBRXABBVDGGX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|