C11H7ClF6OS2 — CID 166641207
1-[3,5-bis(trifluoromethylsulfanyl)phenyl]-3-chloropropan-2-one (PubChem CID 166641207) has the molecular formula C11H7ClF6OS2 and a molecular weight of 368.75 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethylsulfanyl)phenyl]-3-chloropropan-2-one.
| Compound Name | 1-[3,5-bis(trifluoromethylsulfanyl)phenyl]-3-chloropropan-2-one |
|---|---|
| PubChem CID | 166641207 |
| Molecular Formula | C11H7ClF6OS2 |
| Molecular Weight | 368.75 g/mol |
| Exact Mass | 367.95 |
| IUPAC Name | 1-[3,5-bis(trifluoromethylsulfanyl)phenyl]-3-chloropropan-2-one |
| SMILES | O=C(CCl)Cc1cc(SC(F)(F)F)cc(SC(F)(F)F)c1 |
| InChI | InChI=1S/C11H7ClF6OS2/c12-5-7(19)1-6-2-8(20-10(13,14)15)4-9(3-6)21-11(16,17)18/h2-4H,1,5H2 |
| InChIKey | XKDKJZJNSOQRRK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.75 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|