C11H7ClF6OS — CID 170836594
1-chloro-3-[2-(trifluoromethyl)-4-(trifluoromethylsulfanyl)phenyl]propan-2-one (PubChem CID 170836594) has the molecular formula C11H7ClF6OS and a molecular weight of 336.68 g/mol. Its IUPAC name is 1-chloro-3-[2-(trifluoromethyl)-4-(trifluoromethylsulfanyl)phenyl]propan-2-one.
| Compound Name | 1-chloro-3-[2-(trifluoromethyl)-4-(trifluoromethylsulfanyl)phenyl]propan-2-one |
|---|---|
| PubChem CID | 170836594 |
| Molecular Formula | C11H7ClF6OS |
| Molecular Weight | 336.68 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | 1-chloro-3-[2-(trifluoromethyl)-4-(trifluoromethylsulfanyl)phenyl]propan-2-one |
| SMILES | O=C(CCl)Cc1ccc(SC(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C11H7ClF6OS/c12-5-7(19)3-6-1-2-8(20-11(16,17)18)4-9(6)10(13,14)15/h1-2,4H,3,5H2 |
| InChIKey | BUURFJNTIKRXQF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.68 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|