C10H9ClF3NOS — CID 118832405
1-[3-amino-4-(trifluoromethylsulfanyl)phenyl]-3-chloropropan-2-one (PubChem CID 118832405) has the molecular formula C10H9ClF3NOS and a molecular weight of 283.70 g/mol. Its IUPAC name is 1-[3-amino-4-(trifluoromethylsulfanyl)phenyl]-3-chloropropan-2-one.
| Compound Name | 1-[3-amino-4-(trifluoromethylsulfanyl)phenyl]-3-chloropropan-2-one |
|---|---|
| PubChem CID | 118832405 |
| Molecular Formula | C10H9ClF3NOS |
| Molecular Weight | 283.70 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 1-[3-amino-4-(trifluoromethylsulfanyl)phenyl]-3-chloropropan-2-one |
| SMILES | Nc1cc(CC(=O)CCl)ccc1SC(F)(F)F |
| InChI | InChI=1S/C10H9ClF3NOS/c11-5-7(16)3-6-1-2-9(8(15)4-6)17-10(12,13)14/h1-2,4H,3,5,15H2 |
| InChIKey | ISEDQVMCXFHZLX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.70 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|