C10H7BrF4OS — CID 166641354
1-bromo-3-[2-fluoro-5-(trifluoromethylsulfanyl)phenyl]propan-2-one (PubChem CID 166641354) has the molecular formula C10H7BrF4OS and a molecular weight of 331.13 g/mol. Its IUPAC name is 1-bromo-3-[2-fluoro-5-(trifluoromethylsulfanyl)phenyl]propan-2-one.
| Compound Name | 1-bromo-3-[2-fluoro-5-(trifluoromethylsulfanyl)phenyl]propan-2-one |
|---|---|
| PubChem CID | 166641354 |
| Molecular Formula | C10H7BrF4OS |
| Molecular Weight | 331.13 g/mol |
| Exact Mass | 329.93 |
| IUPAC Name | 1-bromo-3-[2-fluoro-5-(trifluoromethylsulfanyl)phenyl]propan-2-one |
| SMILES | O=C(CBr)Cc1cc(SC(F)(F)F)ccc1F |
| InChI | InChI=1S/C10H7BrF4OS/c11-5-7(16)3-6-4-8(1-2-9(6)12)17-10(13,14)15/h1-2,4H,3,5H2 |
| InChIKey | JYHVGFPMODCSRV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.13 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|