C10H7BrF3IOS — CID 166641191
1-bromo-3-[2-iodo-5-(trifluoromethylsulfanyl)phenyl]propan-2-one (PubChem CID 166641191) has the molecular formula C10H7BrF3IOS and a molecular weight of 439.03 g/mol. Its IUPAC name is 1-bromo-3-[2-iodo-5-(trifluoromethylsulfanyl)phenyl]propan-2-one.
| Compound Name | 1-bromo-3-[2-iodo-5-(trifluoromethylsulfanyl)phenyl]propan-2-one |
|---|---|
| PubChem CID | 166641191 |
| Molecular Formula | C10H7BrF3IOS |
| Molecular Weight | 439.03 g/mol |
| Exact Mass | 437.84 |
| IUPAC Name | 1-bromo-3-[2-iodo-5-(trifluoromethylsulfanyl)phenyl]propan-2-one |
| SMILES | O=C(CBr)Cc1cc(SC(F)(F)F)ccc1I |
| InChI | InChI=1S/C10H7BrF3IOS/c11-5-7(16)3-6-4-8(1-2-9(6)15)17-10(12,13)14/h1-2,4H,3,5H2 |
| InChIKey | WTFCACZZTWJYKA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.03 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|