C12H12BrF3OS — CID 134616318
1-bromo-3-[2-ethyl-5-(trifluoromethylsulfanyl)phenyl]propan-2-one (PubChem CID 134616318) has the molecular formula C12H12BrF3OS and a molecular weight of 341.19 g/mol. Its IUPAC name is 1-bromo-3-[2-ethyl-5-(trifluoromethylsulfanyl)phenyl]propan-2-one.
| Compound Name | 1-bromo-3-[2-ethyl-5-(trifluoromethylsulfanyl)phenyl]propan-2-one |
|---|---|
| PubChem CID | 134616318 |
| Molecular Formula | C12H12BrF3OS |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | 1-bromo-3-[2-ethyl-5-(trifluoromethylsulfanyl)phenyl]propan-2-one |
| SMILES | CCc1ccc(SC(F)(F)F)cc1CC(=O)CBr |
| InChI | InChI=1S/C12H12BrF3OS/c1-2-8-3-4-11(18-12(14,15)16)6-9(8)5-10(17)7-13/h3-4,6H,2,5,7H2,1H3 |
| InChIKey | BMMDXQOXGGUIGE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|