C11H8F6OS — CID 166640781
1-[2-(trifluoromethyl)-4-(trifluoromethylsulfanyl)phenyl]propan-1-one (PubChem CID 166640781) has the molecular formula C11H8F6OS and a molecular weight of 302.24 g/mol. Its IUPAC name is 1-[2-(trifluoromethyl)-4-(trifluoromethylsulfanyl)phenyl]propan-1-one.
| Compound Name | 1-[2-(trifluoromethyl)-4-(trifluoromethylsulfanyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 166640781 |
| Molecular Formula | C11H8F6OS |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 1-[2-(trifluoromethyl)-4-(trifluoromethylsulfanyl)phenyl]propan-1-one |
| SMILES | CCC(=O)c1ccc(SC(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C11H8F6OS/c1-2-9(18)7-4-3-6(19-11(15,16)17)5-8(7)10(12,13)14/h3-5H,2H2,1H3 |
| InChIKey | OYTACAYPOYCCQE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |