C11H8F6OS2 — CID 166640837
1-[2,4-bis(trifluoromethylsulfanyl)phenyl]propan-1-one (PubChem CID 166640837) has the molecular formula C11H8F6OS2 and a molecular weight of 334.31 g/mol. Its IUPAC name is 1-[2,4-bis(trifluoromethylsulfanyl)phenyl]propan-1-one.
| Compound Name | 1-[2,4-bis(trifluoromethylsulfanyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 166640837 |
| Molecular Formula | C11H8F6OS2 |
| Molecular Weight | 334.31 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 1-[2,4-bis(trifluoromethylsulfanyl)phenyl]propan-1-one |
| SMILES | CCC(=O)c1ccc(SC(F)(F)F)cc1SC(F)(F)F |
| InChI | InChI=1S/C11H8F6OS2/c1-2-8(18)7-4-3-6(19-10(12,13)14)5-9(7)20-11(15,16)17/h3-5H,2H2,1H3 |
| InChIKey | LVSJADJGZOSFNN-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.31 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |