C11H8F6O2S2 — CID 166641421
3-[3,5-bis(trifluoromethylsulfanyl)phenyl]propanoic acid (PubChem CID 166641421) has the molecular formula C11H8F6O2S2 and a molecular weight of 350.31 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethylsulfanyl)phenyl]propanoic acid.
| Compound Name | 3-[3,5-bis(trifluoromethylsulfanyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 166641421 |
| Molecular Formula | C11H8F6O2S2 |
| Molecular Weight | 350.31 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 3-[3,5-bis(trifluoromethylsulfanyl)phenyl]propanoic acid |
| SMILES | O=C(O)CCc1cc(SC(F)(F)F)cc(SC(F)(F)F)c1 |
| InChI | InChI=1S/C11H8F6O2S2/c12-10(13,14)20-7-3-6(1-2-9(18)19)4-8(5-7)21-11(15,16)17/h3-5H,1-2H2,(H,18,19) |
| InChIKey | OAZFTOXCMVJYNZ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.31 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |