C10H8BrF3O2S — CID 134621767
3-[3-bromo-4-(trifluoromethylsulfanyl)phenyl]propanoic acid (PubChem CID 134621767) has the molecular formula C10H8BrF3O2S and a molecular weight of 329.14 g/mol. Its IUPAC name is 3-[3-bromo-4-(trifluoromethylsulfanyl)phenyl]propanoic acid.
| Compound Name | 3-[3-bromo-4-(trifluoromethylsulfanyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 134621767 |
| Molecular Formula | C10H8BrF3O2S |
| Molecular Weight | 329.14 g/mol |
| Exact Mass | 327.94 |
| IUPAC Name | 3-[3-bromo-4-(trifluoromethylsulfanyl)phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(SC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C10H8BrF3O2S/c11-7-5-6(2-4-9(15)16)1-3-8(7)17-10(12,13)14/h1,3,5H,2,4H2,(H,15,16) |
| InChIKey | YULXPZQBZKTGOB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.14 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |