C11H10BrF3OS — CID 166640694
1-[5-(bromomethyl)-2-(trifluoromethylsulfanyl)phenyl]propan-2-one (PubChem CID 166640694) has the molecular formula C11H10BrF3OS and a molecular weight of 327.17 g/mol. Its IUPAC name is 1-[5-(bromomethyl)-2-(trifluoromethylsulfanyl)phenyl]propan-2-one.
| Compound Name | 1-[5-(bromomethyl)-2-(trifluoromethylsulfanyl)phenyl]propan-2-one |
|---|---|
| PubChem CID | 166640694 |
| Molecular Formula | C11H10BrF3OS |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 325.96 |
| IUPAC Name | 1-[5-(bromomethyl)-2-(trifluoromethylsulfanyl)phenyl]propan-2-one |
| SMILES | CC(=O)Cc1cc(CBr)ccc1SC(F)(F)F |
| InChI | InChI=1S/C11H10BrF3OS/c1-7(16)4-9-5-8(6-12)2-3-10(9)17-11(13,14)15/h2-3,5H,4,6H2,1H3 |
| InChIKey | NJOKEZKWIHTLRR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|