C10H10F3NOS — CID 166641452
1-[4-amino-2-(trifluoromethylsulfanyl)phenyl]propan-2-one (PubChem CID 166641452) has the molecular formula C10H10F3NOS and a molecular weight of 249.26 g/mol. Its IUPAC name is 1-[4-amino-2-(trifluoromethylsulfanyl)phenyl]propan-2-one.
| Compound Name | 1-[4-amino-2-(trifluoromethylsulfanyl)phenyl]propan-2-one |
|---|---|
| PubChem CID | 166641452 |
| Molecular Formula | C10H10F3NOS |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 1-[4-amino-2-(trifluoromethylsulfanyl)phenyl]propan-2-one |
| SMILES | CC(=O)Cc1ccc(N)cc1SC(F)(F)F |
| InChI | InChI=1S/C10H10F3NOS/c1-6(15)4-7-2-3-8(14)5-9(7)16-10(11,12)13/h2-3,5H,4,14H2,1H3 |
| InChIKey | PKDRCQZXGRQFKG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|