C11H9F5O2S — CID 166640675
1-[2-(difluoromethoxy)-5-(trifluoromethylsulfanyl)phenyl]propan-2-one (PubChem CID 166640675) has the molecular formula C11H9F5O2S and a molecular weight of 300.25 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)-5-(trifluoromethylsulfanyl)phenyl]propan-2-one.
| Compound Name | 1-[2-(difluoromethoxy)-5-(trifluoromethylsulfanyl)phenyl]propan-2-one |
|---|---|
| PubChem CID | 166640675 |
| Molecular Formula | C11H9F5O2S |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 1-[2-(difluoromethoxy)-5-(trifluoromethylsulfanyl)phenyl]propan-2-one |
| SMILES | CC(=O)Cc1cc(SC(F)(F)F)ccc1OC(F)F |
| InChI | InChI=1S/C11H9F5O2S/c1-6(17)4-7-5-8(19-11(14,15)16)2-3-9(7)18-10(12)13/h2-3,5,10H,4H2,1H3 |
| InChIKey | IHYZRQMFQGPHTO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |