C11H11F3O2S — CID 135743410
3-[2-methyl-3-(trifluoromethylsulfanyl)phenyl]propanoic acid (PubChem CID 135743410) has the molecular formula C11H11F3O2S and a molecular weight of 264.27 g/mol. Its IUPAC name is 3-[2-methyl-3-(trifluoromethylsulfanyl)phenyl]propanoic acid.
| Compound Name | 3-[2-methyl-3-(trifluoromethylsulfanyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 135743410 |
| Molecular Formula | C11H11F3O2S |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 3-[2-methyl-3-(trifluoromethylsulfanyl)phenyl]propanoic acid |
| SMILES | Cc1c(CCC(=O)O)cccc1SC(F)(F)F |
| InChI | InChI=1S/C11H11F3O2S/c1-7-8(5-6-10(15)16)3-2-4-9(7)17-11(12,13)14/h2-4H,5-6H2,1H3,(H,15,16) |
| InChIKey | OJODBVQWECYHPH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |