C28H15F10NO2 — CID 161087576
(4-fluorophenyl)-[3-fluoro-5-(trifluoromethyl)phenyl]methanone;N-[(4-fluorophenyl)-[3-fluoro-5-(trifluoromethyl)phenyl]methylidene]hydroxylamine (PubChem CID 161087576) has the molecular formula C28H15F10NO2 and a molecular weight of 587.41 g/mol. Its IUPAC name is (4-fluorophenyl)-[3-fluoro-5-(trifluoromethyl)phenyl]methanone;N-[(4-fluorophenyl)-[3-fluoro-5-(trifluoromethyl)phenyl]methylidene]hydroxylamine.
| Compound Name | (4-fluorophenyl)-[3-fluoro-5-(trifluoromethyl)phenyl]methanone;N-[(4-fluorophenyl)-[3-fluoro-5-(trifluoromethyl)phenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 161087576 |
| Molecular Formula | C28H15F10NO2 |
| Molecular Weight | 587.41 g/mol |
| Exact Mass | 587.09 |
| IUPAC Name | (4-fluorophenyl)-[3-fluoro-5-(trifluoromethyl)phenyl]methanone;N-[(4-fluorophenyl)-[3-fluoro-5-(trifluoromethyl)phenyl]methylidene]hydroxylamine |
| SMILES | O=C(c1ccc(F)cc1)c1cc(F)cc(C(F)(F)F)c1.ON=C(c1ccc(F)cc1)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H8F5NO.C14H7F5O/c15-11-3-1-8(2-4-11)13(20-21)9-5-10(14(17,18)19)7-12(16)6-9;15-11-3-1-8(2-4-11)13(20)9-5-10(14(17,18)19)7-12(16)6-9/h1-7,21H;1-7H |
| InChIKey | UGSQNGAYDVXTAA-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.41 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|