C14H7Cl2F3O — CID 114970678
(3,5-dichlorophenyl)-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 114970678) has the molecular formula C14H7Cl2F3O and a molecular weight of 319.11 g/mol. Its IUPAC name is (3,5-dichlorophenyl)-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | (3,5-dichlorophenyl)-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 114970678 |
| Molecular Formula | C14H7Cl2F3O |
| Molecular Weight | 319.11 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | (3,5-dichlorophenyl)-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H7Cl2F3O/c15-11-5-9(6-12(16)7-11)13(20)8-1-3-10(4-2-8)14(17,18)19/h1-7H |
| InChIKey | FDCYLGYMVPIIIL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.11 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |