C14H6F6O — CID 62789591
[4-(trifluoromethyl)phenyl]-(3,4,5-trifluorophenyl)methanone (PubChem CID 62789591) has the molecular formula C14H6F6O and a molecular weight of 304.19 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl]-(3,4,5-trifluorophenyl)methanone.
| Compound Name | [4-(trifluoromethyl)phenyl]-(3,4,5-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 62789591 |
| Molecular Formula | C14H6F6O |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | [4-(trifluoromethyl)phenyl]-(3,4,5-trifluorophenyl)methanone |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H6F6O/c15-10-5-8(6-11(16)12(10)17)13(21)7-1-3-9(4-2-7)14(18,19)20/h1-6H |
| InChIKey | AUNXWPVFMSMCQG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|