C19H11F3O — CID 146008045
(4-phenylphenyl)-(3,4,5-trifluorophenyl)methanone (PubChem CID 146008045) has the molecular formula C19H11F3O and a molecular weight of 312.29 g/mol. Its IUPAC name is (4-phenylphenyl)-(3,4,5-trifluorophenyl)methanone.
| Compound Name | (4-phenylphenyl)-(3,4,5-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 146008045 |
| Molecular Formula | C19H11F3O |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | (4-phenylphenyl)-(3,4,5-trifluorophenyl)methanone |
| SMILES | O=C(c1ccc(-c2ccccc2)cc1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C19H11F3O/c20-16-10-15(11-17(21)18(16)22)19(23)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-11H |
| InChIKey | BOLURDCZUGYHEP-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|