C21H23F6NS — CID 143472913
(Z)-N-tert-butylsulfanyl-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethyl)phenyl]methanimine;ethane (PubChem CID 143472913) has the molecular formula C21H23F6NS and a molecular weight of 435.48 g/mol. Its IUPAC name is (Z)-N-tert-butylsulfanyl-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethyl)phenyl]methanimine;ethane.
| Compound Name | (Z)-N-tert-butylsulfanyl-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethyl)phenyl]methanimine;ethane |
|---|---|
| PubChem CID | 143472913 |
| Molecular Formula | C21H23F6NS |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | (Z)-N-tert-butylsulfanyl-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethyl)phenyl]methanimine;ethane |
| SMILES | CC.CC(C)(C)S/N=C(/c1ccc(F)cc1)c1cc(F)cc(C(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C19H17F6NS.C2H6/c1-18(2,3)27-26-16(11-4-6-14(20)7-5-11)12-8-13(10-15(21)9-12)19(24,25)17(22)23;1-2/h4-10,17H,1-3H3;1-2H3/b26-16-; |
| InChIKey | GGFRWQLTHQLMIC-JCCIBZBCSA-N |
| XLogP | 7.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|